C17H13F2N3O3 — CID 24530023
N-(3,5-difluorophenyl)-3-(1,4-dioxo-3H-phthalazin-2-yl)propanamide (PubChem CID 24530023) has the molecular formula C17H13F2N3O3 and a molecular weight of 345.31 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-3-(1,4-dioxo-3H-phthalazin-2-yl)propanamide.
| Compound Name | N-(3,5-difluorophenyl)-3-(1,4-dioxo-3H-phthalazin-2-yl)propanamide |
|---|---|
| PubChem CID | 24530023 |
| Molecular Formula | C17H13F2N3O3 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-(3,5-difluorophenyl)-3-(1,4-dioxo-3H-phthalazin-2-yl)propanamide |
| SMILES | O=C(CCn1[nH]c(=O)c2ccccc2c1=O)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H13F2N3O3/c18-10-7-11(19)9-12(8-10)20-15(23)5-6-22-17(25)14-4-2-1-3-13(14)16(24)21-22/h1-4,7-9H,5-6H2,(H,20,23)(H,21,24) |
| InChIKey | UWHHXKXDCQUSKH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |