C23H20N4O3 — CID 112773070
N-(2-anilinophenyl)-3-(1,4-dioxo-3H-phthalazin-2-yl)propanamide (PubChem CID 112773070) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is N-(2-anilinophenyl)-3-(1,4-dioxo-3H-phthalazin-2-yl)propanamide.
| Compound Name | N-(2-anilinophenyl)-3-(1,4-dioxo-3H-phthalazin-2-yl)propanamide |
|---|---|
| PubChem CID | 112773070 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-(2-anilinophenyl)-3-(1,4-dioxo-3H-phthalazin-2-yl)propanamide |
| SMILES | O=C(CCn1[nH]c(=O)c2ccccc2c1=O)Nc1ccccc1Nc1ccccc1 |
| InChI | InChI=1S/C23H20N4O3/c28-21(14-15-27-23(30)18-11-5-4-10-17(18)22(29)26-27)25-20-13-7-6-12-19(20)24-16-8-2-1-3-9-16/h1-13,24H,14-15H2,(H,25,28)(H,26,29) |
| InChIKey | UEUOJGCSJCTOHP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |