C26H24N4O4 — CID 33253152
2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]-N-(2-phenylethyl)benzamide (PubChem CID 33253152) has the molecular formula C26H24N4O4 and a molecular weight of 456.50 g/mol. Its IUPAC name is 2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]-N-(2-phenylethyl)benzamide.
| Compound Name | 2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 33253152 |
| Molecular Formula | C26H24N4O4 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]-N-(2-phenylethyl)benzamide |
| SMILES | O=C(CCn1[nH]c(=O)c2ccccc2c1=O)Nc1ccccc1C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C26H24N4O4/c31-23(15-17-30-26(34)20-11-5-4-10-19(20)25(33)29-30)28-22-13-7-6-12-21(22)24(32)27-16-14-18-8-2-1-3-9-18/h1-13H,14-17H2,(H,27,32)(H,28,31)(H,29,33) |
| InChIKey | YULDUVIARGWMDB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |