C15H17N3O5S — CID 119241592
2-[2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]ethylsulfanyl]acetic acid (PubChem CID 119241592) has the molecular formula C15H17N3O5S and a molecular weight of 351.38 g/mol. Its IUPAC name is 2-[2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119241592 |
| Molecular Formula | C15H17N3O5S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 2-[2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]ethylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCNC(=O)CCn1[nH]c(=O)c2ccccc2c1=O |
| InChI | InChI=1S/C15H17N3O5S/c19-12(16-6-8-24-9-13(20)21)5-7-18-15(23)11-4-2-1-3-10(11)14(22)17-18/h1-4H,5-9H2,(H,16,19)(H,17,22)(H,20,21) |
| InChIKey | CBPLLOBJFXWSRD-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|