C16H15N3O3S — CID 32753667
3-(1,4-dioxo-3H-phthalazin-2-yl)-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 32753667) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is 3-(1,4-dioxo-3H-phthalazin-2-yl)-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | 3-(1,4-dioxo-3H-phthalazin-2-yl)-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 32753667 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 3-(1,4-dioxo-3H-phthalazin-2-yl)-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | O=C(CCn1[nH]c(=O)c2ccccc2c1=O)NCc1cccs1 |
| InChI | InChI=1S/C16H15N3O3S/c20-14(17-10-11-4-3-9-23-11)7-8-19-16(22)13-6-2-1-5-12(13)15(21)18-19/h1-6,9H,7-8,10H2,(H,17,20)(H,18,21) |
| InChIKey | UCOUAZHGNBESDZ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |