C15H19N3O3 — CID 32684521
N-[(2S)-butan-2-yl]-3-(1,4-dioxo-3H-phthalazin-2-yl)propanamide (PubChem CID 32684521) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-3-(1,4-dioxo-3H-phthalazin-2-yl)propanamide.
| Compound Name | N-[(2S)-butan-2-yl]-3-(1,4-dioxo-3H-phthalazin-2-yl)propanamide |
|---|---|
| PubChem CID | 32684521 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-[(2S)-butan-2-yl]-3-(1,4-dioxo-3H-phthalazin-2-yl)propanamide |
| SMILES | CC[C@H](C)NC(=O)CCn1[nH]c(=O)c2ccccc2c1=O |
| InChI | InChI=1S/C15H19N3O3/c1-3-10(2)16-13(19)8-9-18-15(21)12-7-5-4-6-11(12)14(20)17-18/h4-7,10H,3,8-9H2,1-2H3,(H,16,19)(H,17,20)/t10-/m0/s1 |
| InChIKey | KQFHLKYRYMVYPV-JTQLQIEISA-N |
| XLogP | 0.99 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |