C17H21N3O5 — CID 119211581
2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]-3-methylpentanoic acid (PubChem CID 119211581) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is 2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]-3-methylpentanoic acid.
| Compound Name | 2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 119211581 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-[3-(1,4-dioxo-3H-phthalazin-2-yl)propanoylamino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)CCn1[nH]c(=O)c2ccccc2c1=O)C(=O)O |
| InChI | InChI=1S/C17H21N3O5/c1-3-10(2)14(17(24)25)18-13(21)8-9-20-16(23)12-7-5-4-6-11(12)15(22)19-20/h4-7,10,14H,3,8-9H2,1-2H3,(H,18,21)(H,19,22)(H,24,25) |
| InChIKey | KRZXNJXCIZQEAP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |