methyl 4-(1,4-dioxo-3H-phthalazin-2-yl)butanoate

C13H14N2O4 — CID 43378338

IUPACmethyl 4-(1,4-dioxo-3H-phthalazin-2-yl)butanoate
SMILESCOC(=O)CCCn1[nH]c(=O)c2ccccc2c1=O
InChIInChI=1S/C13H14N2O4/c1-19-11(16)7-4-8-15-13(18)10-6-3-2-5-9(10)12(17)14-15/h2-3,5-6H,4,7-8H2,1H3,(H,14,17)
InChIKeyUXMSEKDAJLJKGX-UHFFFAOYSA-N
MW262.26 g/mol
LogP0.64
Rot. Bonds4

About methyl 4-(1,4-dioxo-3H-phthalazin-2-yl)butanoate

methyl 4-(1,4-dioxo-3H-phthalazin-2-yl)butanoate (PubChem CID 43378338) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is methyl 4-(1,4-dioxo-3H-phthalazin-2-yl)butanoate.

Molecular Properties

Compound Namemethyl 4-(1,4-dioxo-3H-phthalazin-2-yl)butanoate
PubChem CID43378338
Molecular FormulaC13H14N2O4
Molecular Weight262.26 g/mol
Exact Mass262.10
IUPAC Namemethyl 4-(1,4-dioxo-3H-phthalazin-2-yl)butanoate
SMILESCOC(=O)CCCn1[nH]c(=O)c2ccccc2c1=O
InChIInChI=1S/C13H14N2O4/c1-19-11(16)7-4-8-15-13(18)10-6-3-2-5-9(10)12(17)14-15/h2-3,5-6H,4,7-8H2,1H3,(H,14,17)
InChIKeyUXMSEKDAJLJKGX-UHFFFAOYSA-N
XLogP0.64
TPSA81.16 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.26
LogP ≤ 50.64
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 4-(1,4-dioxo-3H-phthalazin-2-yl)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(1,4-dioxo-3H-phthalazin-2-yl)butanoate?
The IUPAC name of methyl 4-(1,4-dioxo-3H-phthalazin-2-yl)butanoate (CID 43378338) is methyl 4-(1,4-dioxo-3H-phthalazin-2-yl)butanoate.
What is the SMILES notation for methyl 4-(1,4-dioxo-3H-phthalazin-2-yl)butanoate?
The canonical SMILES for methyl 4-(1,4-dioxo-3H-phthalazin-2-yl)butanoate is COC(=O)CCCn1[nH]c(=O)c2ccccc2c1=O.
What is the InChIKey of methyl 4-(1,4-dioxo-3H-phthalazin-2-yl)butanoate?
The InChIKey is UXMSEKDAJLJKGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O4/c1-19-11(16)7-4-8-15-13(18)10-6-3-2-5-9(10)12(17)14-15/h2-3,5-6H,4,7-8H2,1H3,(H,14,17).
What are the key properties of methyl 4-(1,4-dioxo-3H-phthalazin-2-yl)butanoate?
methyl 4-(1,4-dioxo-3H-phthalazin-2-yl)butanoate has a molecular weight of 262.26 g/mol, XLogP of 0.64, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1,4-dioxo-3H-phthalazin-2-yl)butanoate is sourced from PubChem (CID 43378338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).