C15H18N2O4 — CID 652550
butyl 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoate (PubChem CID 652550) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is butyl 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoate.
| Compound Name | butyl 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoate |
|---|---|
| PubChem CID | 652550 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | butyl 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoate |
| SMILES | CCCCOC(=O)CCn1[nH]c(=O)c2ccccc2c1=O |
| InChI | InChI=1S/C15H18N2O4/c1-2-3-10-21-13(18)8-9-17-15(20)12-7-5-4-6-11(12)14(19)16-17/h4-7H,2-3,8-10H2,1H3,(H,16,19) |
| InChIKey | LKQQLTUSZYWCIR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|