C14H16N2O5 — CID 24518425
2-ethoxyethyl 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate (PubChem CID 24518425) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-ethoxyethyl 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate.
| Compound Name | 2-ethoxyethyl 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate |
|---|---|
| PubChem CID | 24518425 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-ethoxyethyl 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate |
| SMILES | CCOCCOC(=O)Cn1[nH]c(=O)c2ccccc2c1=O |
| InChI | InChI=1S/C14H16N2O5/c1-2-20-7-8-21-12(17)9-16-14(19)11-6-4-3-5-10(11)13(18)15-16/h3-6H,2,7-9H2,1H3,(H,15,18) |
| InChIKey | FEGSLACRLLSZSU-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|