C18H13BrN2O5 — CID 18280384
[2-(4-bromophenyl)-2-oxoethyl] 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate (PubChem CID 18280384) has the molecular formula C18H13BrN2O5 and a molecular weight of 417.22 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate |
|---|---|
| PubChem CID | 18280384 |
| Molecular Formula | C18H13BrN2O5 |
| Molecular Weight | 417.22 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate |
| SMILES | O=C(Cn1[nH]c(=O)c2ccccc2c1=O)OCC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H13BrN2O5/c19-12-7-5-11(6-8-12)15(22)10-26-16(23)9-21-18(25)14-4-2-1-3-13(14)17(24)20-21/h1-8H,9-10H2,(H,20,24) |
| InChIKey | JKCCPTZJWTXEPQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |