C17H13BrN2O4 — CID 2619253
(4-bromophenyl)methyl 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate (PubChem CID 2619253) has the molecular formula C17H13BrN2O4 and a molecular weight of 389.21 g/mol. Its IUPAC name is (4-bromophenyl)methyl 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate.
| Compound Name | (4-bromophenyl)methyl 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate |
|---|---|
| PubChem CID | 2619253 |
| Molecular Formula | C17H13BrN2O4 |
| Molecular Weight | 389.21 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | (4-bromophenyl)methyl 2-(1,4-dioxo-3H-phthalazin-2-yl)acetate |
| SMILES | O=C(Cn1[nH]c(=O)c2ccccc2c1=O)OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H13BrN2O4/c18-12-7-5-11(6-8-12)10-24-15(21)9-20-17(23)14-4-2-1-3-13(14)16(22)19-20/h1-8H,9-10H2,(H,19,22) |
| InChIKey | XSHBIOANUOGUEX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.21 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |