About (4-bromophenyl)methyl 2-(4-oxo-3H-phthalazin-1-yl)acetate
(4-bromophenyl)methyl 2-(4-oxo-3H-phthalazin-1-yl)acetate (PubChem CID 7789831) has the molecular formula C17H13BrN2O3
and a molecular weight of 373.21 g/mol. Its IUPAC name is (4-bromophenyl)methyl 2-(4-oxo-3H-phthalazin-1-yl)acetate.
Molecular Properties
| Compound Name | (4-bromophenyl)methyl 2-(4-oxo-3H-phthalazin-1-yl)acetate |
| PubChem CID | 7789831 |
| Molecular Formula | C17H13BrN2O3 |
| Molecular Weight | 373.21 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | (4-bromophenyl)methyl 2-(4-oxo-3H-phthalazin-1-yl)acetate |
| SMILES | O=C(Cc1n[nH]c(=O)c2ccccc12)OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H13BrN2O3/c18-12-7-5-11(6-8-12)10-23-16(21)9-15-13-3-1-2-4-14(13)17(22)20-19-15/h1-8H,9-10H2,(H,20,22) |
| InChIKey | FXGQGCMYWURITR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.21 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-bromophenyl)methyl 2-(4-oxo-3H-phthalazin-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl)methyl 2-(4-oxo-3H-phthalazin-1-yl)acetate?
The IUPAC name of (4-bromophenyl)methyl 2-(4-oxo-3H-phthalazin-1-yl)acetate (CID 7789831) is (4-bromophenyl)methyl 2-(4-oxo-3H-phthalazin-1-yl)acetate.
What is the SMILES notation for (4-bromophenyl)methyl 2-(4-oxo-3H-phthalazin-1-yl)acetate?
The canonical SMILES for (4-bromophenyl)methyl 2-(4-oxo-3H-phthalazin-1-yl)acetate is O=C(Cc1n[nH]c(=O)c2ccccc12)OCc1ccc(Br)cc1.
What is the InChIKey of (4-bromophenyl)methyl 2-(4-oxo-3H-phthalazin-1-yl)acetate?
The InChIKey is FXGQGCMYWURITR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13BrN2O3/c18-12-7-5-11(6-8-12)10-23-16(21)9-15-13-3-1-2-4-14(13)17(22)20-19-15/h1-8H,9-10H2,(H,20,22).
What are the key properties of (4-bromophenyl)methyl 2-(4-oxo-3H-phthalazin-1-yl)acetate?
(4-bromophenyl)methyl 2-(4-oxo-3H-phthalazin-1-yl)acetate has a molecular weight of 373.21 g/mol, XLogP of 2.97, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl)methyl 2-(4-oxo-3H-phthalazin-1-yl)acetate is sourced from PubChem (CID 7789831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).