C17H15N3O3 — CID 17472409
2-(4-oxo-3H-phthalazin-1-yl)-N-phenylmethoxyacetamide (PubChem CID 17472409) has the molecular formula C17H15N3O3 and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-(4-oxo-3H-phthalazin-1-yl)-N-phenylmethoxyacetamide.
| Compound Name | 2-(4-oxo-3H-phthalazin-1-yl)-N-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 17472409 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-(4-oxo-3H-phthalazin-1-yl)-N-phenylmethoxyacetamide |
| SMILES | O=C(Cc1n[nH]c(=O)c2ccccc12)NOCc1ccccc1 |
| InChI | InChI=1S/C17H15N3O3/c21-16(20-23-11-12-6-2-1-3-7-12)10-15-13-8-4-5-9-14(13)17(22)19-18-15/h1-9H,10-11H2,(H,19,22)(H,20,21) |
| InChIKey | IOMAILKDYDAENK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|