C18H15N3O4 — CID 7789870
(2-anilino-2-oxoethyl) 2-(4-oxo-3H-phthalazin-1-yl)acetate (PubChem CID 7789870) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 2-(4-oxo-3H-phthalazin-1-yl)acetate.
| Compound Name | (2-anilino-2-oxoethyl) 2-(4-oxo-3H-phthalazin-1-yl)acetate |
|---|---|
| PubChem CID | 7789870 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | (2-anilino-2-oxoethyl) 2-(4-oxo-3H-phthalazin-1-yl)acetate |
| SMILES | O=C(COC(=O)Cc1n[nH]c(=O)c2ccccc12)Nc1ccccc1 |
| InChI | InChI=1S/C18H15N3O4/c22-16(19-12-6-2-1-3-7-12)11-25-17(23)10-15-13-8-4-5-9-14(13)18(24)21-20-15/h1-9H,10-11H2,(H,19,22)(H,21,24) |
| InChIKey | PXGDHSBHTQSGAY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |