C22H21N3O5 — CID 7432641
[2-[4-(butanoylamino)phenyl]-2-oxoethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate (PubChem CID 7432641) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate.
| Compound Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate |
|---|---|
| PubChem CID | 7432641 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate |
| SMILES | CCCC(=O)Nc1ccc(C(=O)COC(=O)Cc2n[nH]c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C22H21N3O5/c1-2-5-20(27)23-15-10-8-14(9-11-15)19(26)13-30-21(28)12-18-16-6-3-4-7-17(16)22(29)25-24-18/h3-4,6-11H,2,5,12-13H2,1H3,(H,23,27)(H,25,29) |
| InChIKey | ZDXXEQUUMOQDRV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |