C18H13ClFN3O4 — CID 7251476
[2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate (PubChem CID 7251476) has the molecular formula C18H13ClFN3O4 and a molecular weight of 389.77 g/mol. Its IUPAC name is [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate.
| Compound Name | [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate |
|---|---|
| PubChem CID | 7251476 |
| Molecular Formula | C18H13ClFN3O4 |
| Molecular Weight | 389.77 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate |
| SMILES | O=C(COC(=O)Cc1n[nH]c(=O)c2ccccc12)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H13ClFN3O4/c19-13-7-10(5-6-14(13)20)21-16(24)9-27-17(25)8-15-11-3-1-2-4-12(11)18(26)23-22-15/h1-7H,8-9H2,(H,21,24)(H,23,26) |
| InChIKey | OUKRWTXLCDBKGN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.77 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |