C18H14Cl2N2O3S — CID 7542347
2-(2,5-dichlorophenyl)sulfanylethyl 2-(4-oxo-3H-phthalazin-1-yl)acetate (PubChem CID 7542347) has the molecular formula C18H14Cl2N2O3S and a molecular weight of 409.29 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanylethyl 2-(4-oxo-3H-phthalazin-1-yl)acetate.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanylethyl 2-(4-oxo-3H-phthalazin-1-yl)acetate |
|---|---|
| PubChem CID | 7542347 |
| Molecular Formula | C18H14Cl2N2O3S |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanylethyl 2-(4-oxo-3H-phthalazin-1-yl)acetate |
| SMILES | O=C(Cc1n[nH]c(=O)c2ccccc12)OCCSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H14Cl2N2O3S/c19-11-5-6-14(20)16(9-11)26-8-7-25-17(23)10-15-12-3-1-2-4-13(12)18(24)22-21-15/h1-6,9H,7-8,10H2,(H,22,24) |
| InChIKey | SRPRTIANVJWPOT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|