C16H11Cl3N4O2 — CID 34933676
2-(4-oxo-3H-phthalazin-1-yl)-N'-(2,4,6-trichlorophenyl)acetohydrazide (PubChem CID 34933676) has the molecular formula C16H11Cl3N4O2 and a molecular weight of 397.65 g/mol. Its IUPAC name is 2-(4-oxo-3H-phthalazin-1-yl)-N'-(2,4,6-trichlorophenyl)acetohydrazide.
| Compound Name | 2-(4-oxo-3H-phthalazin-1-yl)-N'-(2,4,6-trichlorophenyl)acetohydrazide |
|---|---|
| PubChem CID | 34933676 |
| Molecular Formula | C16H11Cl3N4O2 |
| Molecular Weight | 397.65 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | 2-(4-oxo-3H-phthalazin-1-yl)-N'-(2,4,6-trichlorophenyl)acetohydrazide |
| SMILES | O=C(Cc1n[nH]c(=O)c2ccccc12)NNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C16H11Cl3N4O2/c17-8-5-11(18)15(12(19)6-8)22-21-14(24)7-13-9-3-1-2-4-10(9)16(25)23-20-13/h1-6,22H,7H2,(H,21,24)(H,23,25) |
| InChIKey | XUUARWYWEXDCHK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.65 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|