C17H12Cl2N2O3 — CID 2466498
(2,6-dichlorophenyl)methyl 2-(4-oxo-3H-phthalazin-1-yl)acetate (PubChem CID 2466498) has the molecular formula C17H12Cl2N2O3 and a molecular weight of 363.20 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl 2-(4-oxo-3H-phthalazin-1-yl)acetate.
| Compound Name | (2,6-dichlorophenyl)methyl 2-(4-oxo-3H-phthalazin-1-yl)acetate |
|---|---|
| PubChem CID | 2466498 |
| Molecular Formula | C17H12Cl2N2O3 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | (2,6-dichlorophenyl)methyl 2-(4-oxo-3H-phthalazin-1-yl)acetate |
| SMILES | O=C(Cc1n[nH]c(=O)c2ccccc12)OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H12Cl2N2O3/c18-13-6-3-7-14(19)12(13)9-24-16(22)8-15-10-4-1-2-5-11(10)17(23)21-20-15/h1-7H,8-9H2,(H,21,23) |
| InChIKey | WGKXQPOQQCWYHH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |