C17H13FN4O3 — CID 21213678
2-fluoro-N'-[2-(4-oxo-3H-phthalazin-1-yl)acetyl]benzohydrazide (PubChem CID 21213678) has the molecular formula C17H13FN4O3 and a molecular weight of 340.31 g/mol. Its IUPAC name is 2-fluoro-N'-[2-(4-oxo-3H-phthalazin-1-yl)acetyl]benzohydrazide.
| Compound Name | 2-fluoro-N'-[2-(4-oxo-3H-phthalazin-1-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 21213678 |
| Molecular Formula | C17H13FN4O3 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2-fluoro-N'-[2-(4-oxo-3H-phthalazin-1-yl)acetyl]benzohydrazide |
| SMILES | O=C(Cc1n[nH]c(=O)c2ccccc12)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C17H13FN4O3/c18-13-8-4-3-7-12(13)17(25)22-20-15(23)9-14-10-5-1-2-6-11(10)16(24)21-19-14/h1-8H,9H2,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | DZUNQQBVBWLYKQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|