C22H22FN3O2 — CID 166234080
N-[cyclopentyl-(2-fluorophenyl)methyl]-2-(4-oxo-3H-phthalazin-1-yl)acetamide (PubChem CID 166234080) has the molecular formula C22H22FN3O2 and a molecular weight of 379.44 g/mol. Its IUPAC name is N-[cyclopentyl-(2-fluorophenyl)methyl]-2-(4-oxo-3H-phthalazin-1-yl)acetamide.
| Compound Name | N-[cyclopentyl-(2-fluorophenyl)methyl]-2-(4-oxo-3H-phthalazin-1-yl)acetamide |
|---|---|
| PubChem CID | 166234080 |
| Molecular Formula | C22H22FN3O2 |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | N-[cyclopentyl-(2-fluorophenyl)methyl]-2-(4-oxo-3H-phthalazin-1-yl)acetamide |
| SMILES | O=C(Cc1n[nH]c(=O)c2ccccc12)NC(c1ccccc1F)C1CCCC1 |
| InChI | InChI=1S/C22H22FN3O2/c23-18-12-6-5-11-17(18)21(14-7-1-2-8-14)24-20(27)13-19-15-9-3-4-10-16(15)22(28)26-25-19/h3-6,9-12,14,21H,1-2,7-8,13H2,(H,24,27)(H,26,28) |
| InChIKey | ZMGGCWFYXHMJBS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |