C20H23FN2O — CID 119815702
2-(4-aminophenyl)-N-[cyclopentyl-(2-fluorophenyl)methyl]acetamide (PubChem CID 119815702) has the molecular formula C20H23FN2O and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[cyclopentyl-(2-fluorophenyl)methyl]acetamide.
| Compound Name | 2-(4-aminophenyl)-N-[cyclopentyl-(2-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 119815702 |
| Molecular Formula | C20H23FN2O |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 2-(4-aminophenyl)-N-[cyclopentyl-(2-fluorophenyl)methyl]acetamide |
| SMILES | Nc1ccc(CC(=O)NC(c2ccccc2F)C2CCCC2)cc1 |
| InChI | InChI=1S/C20H23FN2O/c21-18-8-4-3-7-17(18)20(15-5-1-2-6-15)23-19(24)13-14-9-11-16(22)12-10-14/h3-4,7-12,15,20H,1-2,5-6,13,22H2,(H,23,24) |
| InChIKey | NVJONKUCMHAGNY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|