C17H24FNO3S — CID 97053702
N-[(S)-cyclopentyl-(2-fluorophenyl)methyl]-4-methylsulfonylbutanamide (PubChem CID 97053702) has the molecular formula C17H24FNO3S and a molecular weight of 341.45 g/mol. Its IUPAC name is N-[(S)-cyclopentyl-(2-fluorophenyl)methyl]-4-methylsulfonylbutanamide.
| Compound Name | N-[(S)-cyclopentyl-(2-fluorophenyl)methyl]-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 97053702 |
| Molecular Formula | C17H24FNO3S |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N-[(S)-cyclopentyl-(2-fluorophenyl)methyl]-4-methylsulfonylbutanamide |
| SMILES | CS(=O)(=O)CCCC(=O)N[C@H](c1ccccc1F)C1CCCC1 |
| InChI | InChI=1S/C17H24FNO3S/c1-23(21,22)12-6-11-16(20)19-17(13-7-2-3-8-13)14-9-4-5-10-15(14)18/h4-5,9-10,13,17H,2-3,6-8,11-12H2,1H3,(H,19,20)/t17-/m0/s1 |
| InChIKey | JLRWVPSRBOKDDW-KRWDZBQOSA-N |
| XLogP | 3.00 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |