C19H26FN3O2 — CID 97055835
1-N-[(S)-cyclopentyl-(2-fluorophenyl)methyl]piperidine-1,4-dicarboxamide (PubChem CID 97055835) has the molecular formula C19H26FN3O2 and a molecular weight of 347.43 g/mol. Its IUPAC name is 1-N-[(S)-cyclopentyl-(2-fluorophenyl)methyl]piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-[(S)-cyclopentyl-(2-fluorophenyl)methyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 97055835 |
| Molecular Formula | C19H26FN3O2 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 1-N-[(S)-cyclopentyl-(2-fluorophenyl)methyl]piperidine-1,4-dicarboxamide |
| SMILES | NC(=O)C1CCN(C(=O)N[C@H](c2ccccc2F)C2CCCC2)CC1 |
| InChI | InChI=1S/C19H26FN3O2/c20-16-8-4-3-7-15(16)17(13-5-1-2-6-13)22-19(25)23-11-9-14(10-12-23)18(21)24/h3-4,7-8,13-14,17H,1-2,5-6,9-12H2,(H2,21,24)(H,22,25)/t17-/m0/s1 |
| InChIKey | AALZHAXOWVHIMZ-KRWDZBQOSA-N |
| XLogP | 2.96 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |