C17H25N3O2S — CID 94175624
1-N-[(R)-cyclopentyl(thiophen-2-yl)methyl]piperidine-1,4-dicarboxamide (PubChem CID 94175624) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is 1-N-[(R)-cyclopentyl(thiophen-2-yl)methyl]piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-[(R)-cyclopentyl(thiophen-2-yl)methyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 94175624 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 1-N-[(R)-cyclopentyl(thiophen-2-yl)methyl]piperidine-1,4-dicarboxamide |
| SMILES | NC(=O)C1CCN(C(=O)N[C@@H](c2cccs2)C2CCCC2)CC1 |
| InChI | InChI=1S/C17H25N3O2S/c18-16(21)13-7-9-20(10-8-13)17(22)19-15(12-4-1-2-5-12)14-6-3-11-23-14/h3,6,11-13,15H,1-2,4-5,7-10H2,(H2,18,21)(H,19,22)/t15-/m1/s1 |
| InChIKey | QRNLOSCOUXVZSQ-OAHLLOKOSA-N |
| XLogP | 2.89 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |