C22H27N3O2S — CID 39613287
N-[(S)-cyclopentyl(thiophen-2-yl)methyl]-1-(pyridine-3-carbonyl)piperidine-4-carboxamide (PubChem CID 39613287) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is N-[(S)-cyclopentyl(thiophen-2-yl)methyl]-1-(pyridine-3-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[(S)-cyclopentyl(thiophen-2-yl)methyl]-1-(pyridine-3-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 39613287 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N-[(S)-cyclopentyl(thiophen-2-yl)methyl]-1-(pyridine-3-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(N[C@H](c1cccs1)C1CCCC1)C1CCN(C(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C22H27N3O2S/c26-21(24-20(16-5-1-2-6-16)19-8-4-14-28-19)17-9-12-25(13-10-17)22(27)18-7-3-11-23-15-18/h3-4,7-8,11,14-17,20H,1-2,5-6,9-10,12-13H2,(H,24,26)/t20-/m0/s1 |
| InChIKey | OJGMNEURKMWFOP-FQEVSTJZSA-N |
| XLogP | 4.04 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |