C21H27N3O3S2 — CID 46452333
N-[cyclopentyl(thiophen-2-yl)methyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide (PubChem CID 46452333) has the molecular formula C21H27N3O3S2 and a molecular weight of 433.60 g/mol. Its IUPAC name is N-[cyclopentyl(thiophen-2-yl)methyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[cyclopentyl(thiophen-2-yl)methyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 46452333 |
| Molecular Formula | C21H27N3O3S2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | N-[cyclopentyl(thiophen-2-yl)methyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NC(c1cccs1)C1CCCC1)C1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C21H27N3O3S2/c25-21(23-20(16-5-1-2-6-16)19-8-4-14-28-19)17-9-12-24(13-10-17)29(26,27)18-7-3-11-22-15-18/h3-4,7-8,11,14-17,20H,1-2,5-6,9-10,12-13H2,(H,23,25) |
| InChIKey | LYMCPNOIFWCUNQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |