C16H23N3O3S — CID 38653049
N-(cyclobutylmethyl)-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide (PubChem CID 38653049) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(cyclobutylmethyl)-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 38653049 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-(cyclobutylmethyl)-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NCC1CCC1)C1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C16H23N3O3S/c20-16(18-11-13-3-1-4-13)14-6-9-19(10-7-14)23(21,22)15-5-2-8-17-12-15/h2,5,8,12-14H,1,3-4,6-7,9-11H2,(H,18,20) |
| InChIKey | NSQAQXODKZVVJP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |