C16H23N3O3S — CID 90521514
N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]pent-4-enamide (PubChem CID 90521514) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]pent-4-enamide.
| Compound Name | N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]pent-4-enamide |
|---|---|
| PubChem CID | 90521514 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]pent-4-enamide |
| SMILES | C=CCCC(=O)NCC1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C16H23N3O3S/c1-2-3-6-16(20)18-12-14-7-10-19(11-8-14)23(21,22)15-5-4-9-17-13-15/h2,4-5,9,13-14H,1,3,6-8,10-12H2,(H,18,20) |
| InChIKey | RBXLSCUPAPXRFM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|