C23H29N3O6S — CID 90521658
(E)-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 90521658) has the molecular formula C23H29N3O6S and a molecular weight of 475.57 g/mol. Its IUPAC name is (E)-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 90521658 |
| Molecular Formula | C23H29N3O6S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | (E)-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCC2CCN(S(=O)(=O)c3cccnc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C23H29N3O6S/c1-30-20-13-18(14-21(31-2)23(20)32-3)6-7-22(27)25-15-17-8-11-26(12-9-17)33(28,29)19-5-4-10-24-16-19/h4-7,10,13-14,16-17H,8-9,11-12,15H2,1-3H3,(H,25,27)/b7-6+ |
| InChIKey | XSDUJFJECXGMQN-VOTSOKGWSA-N |
| XLogP | 2.34 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|