C20H26N4O3S — CID 90521683
1-(3,5-dimethylphenyl)-3-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]urea (PubChem CID 90521683) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]urea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]urea |
|---|---|
| PubChem CID | 90521683 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]urea |
| SMILES | Cc1cc(C)cc(NC(=O)NCC2CCN(S(=O)(=O)c3cccnc3)CC2)c1 |
| InChI | InChI=1S/C20H26N4O3S/c1-15-10-16(2)12-18(11-15)23-20(25)22-13-17-5-8-24(9-6-17)28(26,27)19-4-3-7-21-14-19/h3-4,7,10-12,14,17H,5-6,8-9,13H2,1-2H3,(H2,22,23,25) |
| InChIKey | ACGUOLSVQPRKIU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |