C21H27N5O4S — CID 90521084
N'-[4-(dimethylamino)phenyl]-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]oxamide (PubChem CID 90521084) has the molecular formula C21H27N5O4S and a molecular weight of 445.55 g/mol. Its IUPAC name is N'-[4-(dimethylamino)phenyl]-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]oxamide.
| Compound Name | N'-[4-(dimethylamino)phenyl]-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]oxamide |
|---|---|
| PubChem CID | 90521084 |
| Molecular Formula | C21H27N5O4S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N'-[4-(dimethylamino)phenyl]-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]oxamide |
| SMILES | CN(C)c1ccc(NC(=O)C(=O)NCC2CCN(S(=O)(=O)c3cccnc3)CC2)cc1 |
| InChI | InChI=1S/C21H27N5O4S/c1-25(2)18-7-5-17(6-8-18)24-21(28)20(27)23-14-16-9-12-26(13-10-16)31(29,30)19-4-3-11-22-15-19/h3-8,11,15-16H,9-10,12-14H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | MGLWIMFPRLQWLM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|