C20H24N4O4S — CID 90521058
N'-(2-methylphenyl)-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]oxamide (PubChem CID 90521058) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is N'-(2-methylphenyl)-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]oxamide.
| Compound Name | N'-(2-methylphenyl)-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]oxamide |
|---|---|
| PubChem CID | 90521058 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N'-(2-methylphenyl)-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]oxamide |
| SMILES | Cc1ccccc1NC(=O)C(=O)NCC1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C20H24N4O4S/c1-15-5-2-3-7-18(15)23-20(26)19(25)22-13-16-8-11-24(12-9-16)29(27,28)17-6-4-10-21-14-17/h2-7,10,14,16H,8-9,11-13H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | XJVDTSBLDFMGDA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|