C16H19N5O5S — CID 71786358
N'-(1,2-oxazol-3-yl)-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]oxamide (PubChem CID 71786358) has the molecular formula C16H19N5O5S and a molecular weight of 393.43 g/mol. Its IUPAC name is N'-(1,2-oxazol-3-yl)-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]oxamide.
| Compound Name | N'-(1,2-oxazol-3-yl)-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]oxamide |
|---|---|
| PubChem CID | 71786358 |
| Molecular Formula | C16H19N5O5S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N'-(1,2-oxazol-3-yl)-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]oxamide |
| SMILES | O=C(NCC1CCN(S(=O)(=O)c2cccnc2)CC1)C(=O)Nc1ccon1 |
| InChI | InChI=1S/C16H19N5O5S/c22-15(16(23)19-14-5-9-26-20-14)18-10-12-3-7-21(8-4-12)27(24,25)13-2-1-6-17-11-13/h1-2,5-6,9,11-12H,3-4,7-8,10H2,(H,18,22)(H,19,20,23) |
| InChIKey | SFNHFUYLIQPMPH-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 134.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|