C20H25N3O3S — CID 20851608
1-pyridin-3-ylsulfonyl-N-(2,4,6-trimethylphenyl)piperidine-4-carboxamide (PubChem CID 20851608) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is 1-pyridin-3-ylsulfonyl-N-(2,4,6-trimethylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-pyridin-3-ylsulfonyl-N-(2,4,6-trimethylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20851608 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 1-pyridin-3-ylsulfonyl-N-(2,4,6-trimethylphenyl)piperidine-4-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)C2CCN(S(=O)(=O)c3cccnc3)CC2)c(C)c1 |
| InChI | InChI=1S/C20H25N3O3S/c1-14-11-15(2)19(16(3)12-14)22-20(24)17-6-9-23(10-7-17)27(25,26)18-5-4-8-21-13-18/h4-5,8,11-13,17H,6-7,9-10H2,1-3H3,(H,22,24) |
| InChIKey | UFSAERRPNICQAR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |