C21H26N4O4S — CID 30885894
N-(4-morpholin-4-ylphenyl)-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide (PubChem CID 30885894) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(4-morpholin-4-ylphenyl)-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 30885894 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1)C1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C21H26N4O4S/c26-21(23-18-3-5-19(6-4-18)24-12-14-29-15-13-24)17-7-10-25(11-8-17)30(27,28)20-2-1-9-22-16-20/h1-6,9,16-17H,7-8,10-15H2,(H,23,26) |
| InChIKey | HXMDTNOETCEVIH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|