C26H34N4O5S — CID 110199911
1-(benzenesulfonyl)-N-(4-morpholin-4-ylphenyl)-4-oxo-1,5-diazacycloundecane-8-carboxamide (PubChem CID 110199911) has the molecular formula C26H34N4O5S and a molecular weight of 514.65 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(4-morpholin-4-ylphenyl)-4-oxo-1,5-diazacycloundecane-8-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-(4-morpholin-4-ylphenyl)-4-oxo-1,5-diazacycloundecane-8-carboxamide |
|---|---|
| PubChem CID | 110199911 |
| Molecular Formula | C26H34N4O5S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(4-morpholin-4-ylphenyl)-4-oxo-1,5-diazacycloundecane-8-carboxamide |
| SMILES | O=C1CCN(S(=O)(=O)c2ccccc2)CCCC(C(=O)Nc2ccc(N3CCOCC3)cc2)CCN1 |
| InChI | InChI=1S/C26H34N4O5S/c31-25-13-16-30(36(33,34)24-6-2-1-3-7-24)15-4-5-21(12-14-27-25)26(32)28-22-8-10-23(11-9-22)29-17-19-35-20-18-29/h1-3,6-11,21H,4-5,12-20H2,(H,27,31)(H,28,32) |
| InChIKey | ICCBUCHCRCJSAE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|