C20H29N3O5S — CID 110199920
5-(benzenesulfonyl)-9-(morpholine-4-carbonyl)-1,5-diazacycloundecan-2-one (PubChem CID 110199920) has the molecular formula C20H29N3O5S and a molecular weight of 423.54 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-9-(morpholine-4-carbonyl)-1,5-diazacycloundecan-2-one.
| Compound Name | 5-(benzenesulfonyl)-9-(morpholine-4-carbonyl)-1,5-diazacycloundecan-2-one |
|---|---|
| PubChem CID | 110199920 |
| Molecular Formula | C20H29N3O5S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 5-(benzenesulfonyl)-9-(morpholine-4-carbonyl)-1,5-diazacycloundecan-2-one |
| SMILES | O=C1CCN(S(=O)(=O)c2ccccc2)CCCC(C(=O)N2CCOCC2)CCN1 |
| InChI | InChI=1S/C20H29N3O5S/c24-19-9-12-23(29(26,27)18-6-2-1-3-7-18)11-4-5-17(8-10-21-19)20(25)22-13-15-28-16-14-22/h1-3,6-7,17H,4-5,8-16H2,(H,21,24) |
| InChIKey | HTDGEKCHKGIYEG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |