C19H29N3O4S — CID 110200941
8-(benzenesulfonyl)-1-(oxan-4-yl)-1,4,8-triazacycloundecan-5-one (PubChem CID 110200941) has the molecular formula C19H29N3O4S and a molecular weight of 395.53 g/mol. Its IUPAC name is 8-(benzenesulfonyl)-1-(oxan-4-yl)-1,4,8-triazacycloundecan-5-one.
| Compound Name | 8-(benzenesulfonyl)-1-(oxan-4-yl)-1,4,8-triazacycloundecan-5-one |
|---|---|
| PubChem CID | 110200941 |
| Molecular Formula | C19H29N3O4S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 8-(benzenesulfonyl)-1-(oxan-4-yl)-1,4,8-triazacycloundecan-5-one |
| SMILES | O=C1CCN(S(=O)(=O)c2ccccc2)CCCN(C2CCOCC2)CCN1 |
| InChI | InChI=1S/C19H29N3O4S/c23-19-7-13-22(27(24,25)18-5-2-1-3-6-18)12-4-11-21(14-10-20-19)17-8-15-26-16-9-17/h1-3,5-6,17H,4,7-16H2,(H,20,23) |
| InChIKey | YULBUSSUCXNODT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |