C23H29N3O5S — CID 110200878
8-(benzenesulfonyl)-1-(2-phenylmethoxyacetyl)-1,4,8-triazacycloundecan-5-one (PubChem CID 110200878) has the molecular formula C23H29N3O5S and a molecular weight of 459.57 g/mol. Its IUPAC name is 8-(benzenesulfonyl)-1-(2-phenylmethoxyacetyl)-1,4,8-triazacycloundecan-5-one.
| Compound Name | 8-(benzenesulfonyl)-1-(2-phenylmethoxyacetyl)-1,4,8-triazacycloundecan-5-one |
|---|---|
| PubChem CID | 110200878 |
| Molecular Formula | C23H29N3O5S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 8-(benzenesulfonyl)-1-(2-phenylmethoxyacetyl)-1,4,8-triazacycloundecan-5-one |
| SMILES | O=C1CCN(S(=O)(=O)c2ccccc2)CCCN(C(=O)COCc2ccccc2)CCN1 |
| InChI | InChI=1S/C23H29N3O5S/c27-22-12-16-26(32(29,30)21-10-5-2-6-11-21)15-7-14-25(17-13-24-22)23(28)19-31-18-20-8-3-1-4-9-20/h1-6,8-11H,7,12-19H2,(H,24,27) |
| InChIKey | MXLZYTKPHRQJIE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |