C14H22ClN3O3S — CID 146064783
8-(benzenesulfonyl)-1,4,8-triazacycloundecan-5-one;hydrochloride (PubChem CID 146064783) has the molecular formula C14H22ClN3O3S and a molecular weight of 347.87 g/mol. Its IUPAC name is 8-(benzenesulfonyl)-1,4,8-triazacycloundecan-5-one;hydrochloride.
| Compound Name | 8-(benzenesulfonyl)-1,4,8-triazacycloundecan-5-one;hydrochloride |
|---|---|
| PubChem CID | 146064783 |
| Molecular Formula | C14H22ClN3O3S |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 8-(benzenesulfonyl)-1,4,8-triazacycloundecan-5-one;hydrochloride |
| SMILES | Cl.O=C1CCN(S(=O)(=O)c2ccccc2)CCCNCCN1 |
| InChI | InChI=1S/C14H21N3O3S.ClH/c18-14-7-12-17(11-4-8-15-9-10-16-14)21(19,20)13-5-2-1-3-6-13;/h1-3,5-6,15H,4,7-12H2,(H,16,18);1H |
| InChIKey | UJYQEIKCDNOZNK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |