C15H23ClN2O2S — CID 155843749
3-(benzenesulfonyl)-3,9-diazaspiro[5.5]undecane;hydrochloride (PubChem CID 155843749) has the molecular formula C15H23ClN2O2S and a molecular weight of 330.88 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-3,9-diazaspiro[5.5]undecane;hydrochloride.
| Compound Name | 3-(benzenesulfonyl)-3,9-diazaspiro[5.5]undecane;hydrochloride |
|---|---|
| PubChem CID | 155843749 |
| Molecular Formula | C15H23ClN2O2S |
| Molecular Weight | 330.88 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 3-(benzenesulfonyl)-3,9-diazaspiro[5.5]undecane;hydrochloride |
| SMILES | Cl.O=S(=O)(c1ccccc1)N1CCC2(CCNCC2)CC1 |
| InChI | InChI=1S/C15H22N2O2S.ClH/c18-20(19,14-4-2-1-3-5-14)17-12-8-15(9-13-17)6-10-16-11-7-15;/h1-5,16H,6-13H2;1H |
| InChIKey | FNKLPFPXCLZUKH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.88 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |