C18H21N3O2S — CID 3235527
7-(benzenesulfonyl)-2-pyridin-2-yl-2,7-diazaspiro[3.5]nonane (PubChem CID 3235527) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 7-(benzenesulfonyl)-2-pyridin-2-yl-2,7-diazaspiro[3.5]nonane.
| Compound Name | 7-(benzenesulfonyl)-2-pyridin-2-yl-2,7-diazaspiro[3.5]nonane |
|---|---|
| PubChem CID | 3235527 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 7-(benzenesulfonyl)-2-pyridin-2-yl-2,7-diazaspiro[3.5]nonane |
| SMILES | O=S(=O)(c1ccccc1)N1CCC2(CC1)CN(c1ccccn1)C2 |
| InChI | InChI=1S/C18H21N3O2S/c22-24(23,16-6-2-1-3-7-16)21-12-9-18(10-13-21)14-20(15-18)17-8-4-5-11-19-17/h1-8,11H,9-10,12-15H2 |
| InChIKey | YLKFQKPLNMHTFX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |