C19H23N3O2S — CID 3235151
(5S)-7-(benzenesulfonyl)-2-pyridin-4-yl-2,7-diazaspiro[4.5]decane (PubChem CID 3235151) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is (5S)-7-(benzenesulfonyl)-2-pyridin-4-yl-2,7-diazaspiro[4.5]decane.
| Compound Name | (5S)-7-(benzenesulfonyl)-2-pyridin-4-yl-2,7-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 3235151 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (5S)-7-(benzenesulfonyl)-2-pyridin-4-yl-2,7-diazaspiro[4.5]decane |
| SMILES | O=S(=O)(c1ccccc1)N1CCC[C@@]2(CCN(c3ccncc3)C2)C1 |
| InChI | InChI=1S/C19H23N3O2S/c23-25(24,18-5-2-1-3-6-18)22-13-4-9-19(16-22)10-14-21(15-19)17-7-11-20-12-8-17/h1-3,5-8,11-12H,4,9-10,13-16H2/t19-/m0/s1 |
| InChIKey | SOVDEBPQOUCPEZ-IBGZPJMESA-N |
| XLogP | 2.76 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |