C14H21N3O2S — CID 3234926
(5S)-7-methylsulfonyl-2-pyridin-2-yl-2,7-diazaspiro[4.5]decane (PubChem CID 3234926) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is (5S)-7-methylsulfonyl-2-pyridin-2-yl-2,7-diazaspiro[4.5]decane.
| Compound Name | (5S)-7-methylsulfonyl-2-pyridin-2-yl-2,7-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 3234926 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (5S)-7-methylsulfonyl-2-pyridin-2-yl-2,7-diazaspiro[4.5]decane |
| SMILES | CS(=O)(=O)N1CCC[C@@]2(CCN(c3ccccn3)C2)C1 |
| InChI | InChI=1S/C14H21N3O2S/c1-20(18,19)17-9-4-6-14(12-17)7-10-16(11-14)13-5-2-3-8-15-13/h2-3,5,8H,4,6-7,9-12H2,1H3/t14-/m0/s1 |
| InChIKey | GTXCWPSZTQQKNQ-AWEZNQCLSA-N |
| XLogP | 1.33 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |