C16H24N2O2S — CID 3233118
(5S)-2-benzyl-7-methylsulfonyl-2,7-diazaspiro[4.5]decane (PubChem CID 3233118) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is (5S)-2-benzyl-7-methylsulfonyl-2,7-diazaspiro[4.5]decane.
| Compound Name | (5S)-2-benzyl-7-methylsulfonyl-2,7-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 3233118 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (5S)-2-benzyl-7-methylsulfonyl-2,7-diazaspiro[4.5]decane |
| SMILES | CS(=O)(=O)N1CCC[C@@]2(CCN(Cc3ccccc3)C2)C1 |
| InChI | InChI=1S/C16H24N2O2S/c1-21(19,20)18-10-5-8-16(14-18)9-11-17(13-16)12-15-6-3-2-4-7-15/h2-4,6-7H,5,8-14H2,1H3/t16-/m0/s1 |
| InChIKey | TVUZQTCBEDNSIC-INIZCTEOSA-N |
| XLogP | 1.93 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |