C15H22N2 — CID 2868838
2-benzyl-7-methyl-2,7-diazaspiro[4.4]nonane (PubChem CID 2868838) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 2-benzyl-7-methyl-2,7-diazaspiro[4.4]nonane.
| Compound Name | 2-benzyl-7-methyl-2,7-diazaspiro[4.4]nonane |
|---|---|
| PubChem CID | 2868838 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2-benzyl-7-methyl-2,7-diazaspiro[4.4]nonane |
| SMILES | CN1CCC2(CCN(Cc3ccccc3)C2)C1 |
| InChI | InChI=1S/C15H22N2/c1-16-9-7-15(12-16)8-10-17(13-15)11-14-5-3-2-4-6-14/h2-6H,7-13H2,1H3 |
| InChIKey | JGYPHXHSHDDFRM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |