About (5R)-2-benzyl-2,7-diazaspiro[4.4]nonane
(5R)-2-benzyl-2,7-diazaspiro[4.4]nonane (PubChem CID 34178522) has the molecular formula C14H20N2
and a molecular weight of 216.33 g/mol. Its IUPAC name is (5R)-2-benzyl-2,7-diazaspiro[4.4]nonane.
Molecular Properties
| Compound Name | (5R)-2-benzyl-2,7-diazaspiro[4.4]nonane |
| PubChem CID | 34178522 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (5R)-2-benzyl-2,7-diazaspiro[4.4]nonane |
| SMILES | c1ccc(CN2CC[C@@]3(CCNC3)C2)cc1 |
| InChI | InChI=1S/C14H20N2/c1-2-4-13(5-3-1)10-16-9-7-14(12-16)6-8-15-11-14/h1-5,15H,6-12H2/t14-/m1/s1 |
| InChIKey | ZLFPWTIKFBLPGM-CQSZACIVSA-N |
| XLogP | 1.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-2-benzyl-2,7-diazaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-2-benzyl-2,7-diazaspiro[4.4]nonane?
The IUPAC name of (5R)-2-benzyl-2,7-diazaspiro[4.4]nonane (CID 34178522) is (5R)-2-benzyl-2,7-diazaspiro[4.4]nonane.
What is the SMILES notation for (5R)-2-benzyl-2,7-diazaspiro[4.4]nonane?
The canonical SMILES for (5R)-2-benzyl-2,7-diazaspiro[4.4]nonane is c1ccc(CN2CC[C@@]3(CCNC3)C2)cc1.
What is the InChIKey of (5R)-2-benzyl-2,7-diazaspiro[4.4]nonane?
The InChIKey is ZLFPWTIKFBLPGM-CQSZACIVSA-N. The full InChI is InChI=1S/C14H20N2/c1-2-4-13(5-3-1)10-16-9-7-14(12-16)6-8-15-11-14/h1-5,15H,6-12H2/t14-/m1/s1.
What are the key properties of (5R)-2-benzyl-2,7-diazaspiro[4.4]nonane?
(5R)-2-benzyl-2,7-diazaspiro[4.4]nonane has a molecular weight of 216.33 g/mol, XLogP of 1.87, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-2-benzyl-2,7-diazaspiro[4.4]nonane is sourced from PubChem (CID 34178522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).