C14H20N2 — CID 34178522
(5R)-2-benzyl-2,7-diazaspiro[4.4]nonane (PubChem CID 34178522) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is (5R)-2-benzyl-2,7-diazaspiro[4.4]nonane.
| Compound Name | (5R)-2-benzyl-2,7-diazaspiro[4.4]nonane |
|---|---|
| PubChem CID | 34178522 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (5R)-2-benzyl-2,7-diazaspiro[4.4]nonane |
| SMILES | c1ccc(CN2CC[C@@]3(CCNC3)C2)cc1 |
| InChI | InChI=1S/C14H20N2/c1-2-4-13(5-3-1)10-16-9-7-14(12-16)6-8-15-11-14/h1-5,15H,6-12H2/t14-/m1/s1 |
| InChIKey | ZLFPWTIKFBLPGM-CQSZACIVSA-N |
| XLogP | 1.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |