C12H17ClN2 — CID 57416961
2-benzyl-2,6-diazaspiro[3.3]heptane;hydrochloride (PubChem CID 57416961) has the molecular formula C12H17ClN2 and a molecular weight of 224.74 g/mol. Its IUPAC name is 2-benzyl-2,6-diazaspiro[3.3]heptane;hydrochloride.
| Compound Name | 2-benzyl-2,6-diazaspiro[3.3]heptane;hydrochloride |
|---|---|
| PubChem CID | 57416961 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.74 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-benzyl-2,6-diazaspiro[3.3]heptane;hydrochloride |
| SMILES | Cl.c1ccc(CN2CC3(CNC3)C2)cc1 |
| InChI | InChI=1S/C12H16N2.ClH/c1-2-4-11(5-3-1)6-14-9-12(10-14)7-13-8-12;/h1-5,13H,6-10H2;1H |
| InChIKey | NSAGWYJBYHHNCX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.74 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |